C14H24N6O3S — CID 109432725
N-(2-ethylsulfonylethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109432725) has the molecular formula C14H24N6O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-(2-ethylsulfonylethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109432725 |
| Molecular Formula | C14H24N6O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C14H24N6O3S/c1-4-24(22,23)8-5-16-14(15-2)19-6-7-20(13(21)11-19)12-9-17-18(3)10-12/h9-10H,4-8,11H2,1-3H3,(H,15,16) |
| InChIKey | XGFYQYZALBOZCW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|