C12H18F2N6O — CID 109434389
N-(2,2-difluoroethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109434389) has the molecular formula C12H18F2N6O and a molecular weight of 300.31 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-(2,2-difluoroethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109434389 |
| Molecular Formula | C12H18F2N6O |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(F)F)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C12H18F2N6O/c1-15-12(16-6-10(13)14)19-3-4-20(11(21)8-19)9-5-17-18(2)7-9/h5,7,10H,3-4,6,8H2,1-2H3,(H,15,16) |
| InChIKey | NEDOKOYQACCOTJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|