C15H25N7O3S — CID 109432775
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109432775) has the molecular formula C15H25N7O3S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109432775 |
| Molecular Formula | C15H25N7O3S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN1CCCS1(=O)=O)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C15H25N7O3S/c1-16-15(17-4-6-21-5-3-9-26(21,24)25)20-7-8-22(14(23)12-20)13-10-18-19(2)11-13/h10-11H,3-9,12H2,1-2H3,(H,16,17) |
| InChIKey | ACALPURFKVZZFY-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|