C17H31IN6O2 — CID 109433584
N-ethyl-N'-[2-(2-methylpropoxy)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109433584) has the molecular formula C17H31IN6O2 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-methylpropoxy)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(2-methylpropoxy)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109433584 |
| Molecular Formula | C17H31IN6O2 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-ethyl-N'-[2-(2-methylpropoxy)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCOCC(C)C)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C17H30N6O2.HI/c1-5-18-17(19-6-9-25-13-14(2)3)22-7-8-23(16(24)12-22)15-10-20-21(4)11-15;/h10-11,14H,5-9,12-13H2,1-4H3,(H,18,19);1H |
| InChIKey | IHLGVBATQCERRU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|