C18H33IN6O — CID 109436546
N'-(4,4-dimethylpentyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109436546) has the molecular formula C18H33IN6O and a molecular weight of 476.41 g/mol. Its IUPAC name is N'-(4,4-dimethylpentyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(4,4-dimethylpentyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109436546 |
| Molecular Formula | C18H33IN6O |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N'-(4,4-dimethylpentyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCC(C)(C)C)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C18H32N6O.HI/c1-6-19-17(20-9-7-8-18(2,3)4)23-10-11-24(16(25)14-23)15-12-21-22(5)13-15;/h12-13H,6-11,14H2,1-5H3,(H,19,20);1H |
| InChIKey | HVSDSFRPFFNNAJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|