C21H37N7O — CID 109436571
N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5-piperidin-1-ylpentyl)piperazine-1-carboximidamide (PubChem CID 109436571) has the molecular formula C21H37N7O and a molecular weight of 403.58 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5-piperidin-1-ylpentyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5-piperidin-1-ylpentyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436571 |
| Molecular Formula | C21H37N7O |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(5-piperidin-1-ylpentyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCCN1CCCCC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C21H37N7O/c1-3-22-21(23-10-6-4-7-11-26-12-8-5-9-13-26)27-14-15-28(20(29)18-27)19-16-24-25(2)17-19/h16-17H,3-15,18H2,1-2H3,(H,22,23) |
| InChIKey | GSBPLFKTKIIGKI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|