C14H25IN6OS — CID 109434746
N-ethyl-4-(1-methylpyrazol-4-yl)-N'-(2-methylsulfanylethyl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109434746) has the molecular formula C14H25IN6OS and a molecular weight of 452.37 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-N'-(2-methylsulfanylethyl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-N'-(2-methylsulfanylethyl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434746 |
| Molecular Formula | C14H25IN6OS |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-N'-(2-methylsulfanylethyl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCSC)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C14H24N6OS.HI/c1-4-15-14(16-5-8-22-3)19-6-7-20(13(21)11-19)12-9-17-18(2)10-12;/h9-10H,4-8,11H2,1-3H3,(H,15,16);1H |
| InChIKey | WKZGDPWTSJXKPJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|