C16H24IN9O3 — CID 109434574
N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109434574) has the molecular formula C16H24IN9O3 and a molecular weight of 517.33 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434574 |
| Molecular Formula | C16H24IN9O3 |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(4-nitropyrazol-1-yl)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCn1cc([N+](=O)[O-])cn1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C16H23N9O3.HI/c1-3-17-16(18-4-5-23-11-14(9-20-23)25(27)28)22-6-7-24(15(26)12-22)13-8-19-21(2)10-13;/h8-11H,3-7,12H2,1-2H3,(H,17,18);1H |
| InChIKey | CPMSXMLCXKZXMV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|