C13H21F2IN6O — CID 109434098
N'-(2,2-difluoroethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109434098) has the molecular formula C13H21F2IN6O and a molecular weight of 442.25 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2,2-difluoroethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434098 |
| Molecular Formula | C13H21F2IN6O |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(F)F)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C13H20F2N6O.HI/c1-3-16-13(17-7-11(14)15)20-4-5-21(12(22)9-20)10-6-18-19(2)8-10;/h6,8,11H,3-5,7,9H2,1-2H3,(H,16,17);1H |
| InChIKey | LCCVTKPDSWECOE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|