C18H33IN6O2 — CID 109435134
N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109435134) has the molecular formula C18H33IN6O2 and a molecular weight of 492.41 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109435134 |
| Molecular Formula | C18H33IN6O2 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCC(CCO)C/N=C(\NCC)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C18H32N6O2.HI/c1-4-6-15(7-10-25)11-20-18(19-5-2)23-8-9-24(17(26)14-23)16-12-21-22(3)13-16;/h12-13,15,25H,4-11,14H2,1-3H3,(H,19,20);1H |
| InChIKey | DYKGEMBLQKYFLL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|