C20H36N8O — CID 109435707
N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435707) has the molecular formula C20H36N8O and a molecular weight of 404.56 g/mol. Its IUPAC name is N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435707 |
| Molecular Formula | C20H36N8O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | N-ethyl-N'-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)CN1CCN(C)CC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C20H36N8O/c1-5-21-20(22-12-17(2)14-26-8-6-24(3)7-9-26)27-10-11-28(19(29)16-27)18-13-23-25(4)15-18/h13,15,17H,5-12,14,16H2,1-4H3,(H,21,22) |
| InChIKey | ZWDOVRYWDBSCNP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|