C19H29N7OS — CID 109435741
N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435741) has the molecular formula C19H29N7OS and a molecular weight of 403.56 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435741 |
| Molecular Formula | C19H29N7OS |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | N'-[2-(dimethylamino)-2-thiophen-2-ylethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(c1cccs1)N(C)C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C19H29N7OS/c1-5-20-19(21-12-16(23(2)3)17-7-6-10-28-17)25-8-9-26(18(27)14-25)15-11-22-24(4)13-15/h6-7,10-11,13,16H,5,8-9,12,14H2,1-4H3,(H,20,21) |
| InChIKey | JFCNXMMRTRSRCT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|