C22H33N7O2 — CID 109433643
N'-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109433643) has the molecular formula C22H33N7O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433643 |
| Molecular Formula | C22H33N7O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | N'-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(c1cccc(OC)c1)N(C)C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C22H33N7O2/c1-6-23-22(24-14-20(26(2)3)17-8-7-9-19(12-17)31-5)28-10-11-29(21(30)16-28)18-13-25-27(4)15-18/h7-9,12-13,15,20H,6,10-11,14,16H2,1-5H3,(H,23,24) |
| InChIKey | SKFAPMAADRIJBO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|