C20H28N6O3 — CID 109436095
N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436095) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436095 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N-ethyl-N'-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC)c1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C20H28N6O3/c1-4-21-20(22-12-18(27)15-6-5-7-17(10-15)29-3)25-8-9-26(19(28)14-25)16-11-23-24(2)13-16/h5-7,10-11,13,18,27H,4,8-9,12,14H2,1-3H3,(H,21,22) |
| InChIKey | SOIVMKIHZONKCT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|