C22H32N6O2 — CID 109436071
N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[2-(3-propoxyphenyl)ethyl]piperazine-1-carboximidamide (PubChem CID 109436071) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[2-(3-propoxyphenyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[2-(3-propoxyphenyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436071 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[2-(3-propoxyphenyl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCCOc1cccc(CC/N=C(\NCC)N2CCN(c3cnn(C)c3)C(=O)C2)c1 |
| InChI | InChI=1S/C22H32N6O2/c1-4-13-30-20-8-6-7-18(14-20)9-10-24-22(23-5-2)27-11-12-28(21(29)17-27)19-15-25-26(3)16-19/h6-8,14-16H,4-5,9-13,17H2,1-3H3,(H,23,24) |
| InChIKey | AWYFZEYLPUHSQW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|