C20H29IN6O — CID 109435240
N-ethyl-N'-[2-(3-methylphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109435240) has the molecular formula C20H29IN6O and a molecular weight of 496.40 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-methylphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(3-methylphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109435240 |
| Molecular Formula | C20H29IN6O |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-ethyl-N'-[2-(3-methylphenyl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccc(C)c1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C20H28N6O.HI/c1-4-21-20(22-9-8-17-7-5-6-16(2)12-17)25-10-11-26(19(27)15-25)18-13-23-24(3)14-18;/h5-7,12-14H,4,8-11,15H2,1-3H3,(H,21,22);1H |
| InChIKey | GYAMOGYFDWKWIZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|