C23H36IN7O — CID 109435130
N'-[3-[benzyl(methyl)amino]butyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109435130) has the molecular formula C23H36IN7O and a molecular weight of 553.49 g/mol. Its IUPAC name is N'-[3-[benzyl(methyl)amino]butyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-[benzyl(methyl)amino]butyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109435130 |
| Molecular Formula | C23H36IN7O |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | N'-[3-[benzyl(methyl)amino]butyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(C)N(C)Cc1ccccc1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C23H35N7O.HI/c1-5-24-23(25-12-11-19(2)27(3)16-20-9-7-6-8-10-20)29-13-14-30(22(31)18-29)21-15-26-28(4)17-21;/h6-10,15,17,19H,5,11-14,16,18H2,1-4H3,(H,24,25);1H |
| InChIKey | ILBRHOHGQFZSKQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|