C19H27IN6OS — CID 109434724
N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109434724) has the molecular formula C19H27IN6OS and a molecular weight of 514.44 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434724 |
| Molecular Formula | C19H27IN6OS |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCSc1ccccc1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C19H26N6OS.HI/c1-3-20-19(21-9-12-27-17-7-5-4-6-8-17)24-10-11-25(18(26)15-24)16-13-22-23(2)14-16;/h4-8,13-14H,3,9-12,15H2,1-2H3,(H,20,21);1H |
| InChIKey | RYKPGXVLJXKIMI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|