C19H26IN7O2 — CID 109435800
3-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 109435800) has the molecular formula C19H26IN7O2 and a molecular weight of 511.37 g/mol. Its IUPAC name is 3-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109435800 |
| Molecular Formula | C19H26IN7O2 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 3-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C19H25N7O2.HI/c1-3-21-19(22-10-14-5-4-6-15(9-14)18(20)28)25-7-8-26(17(27)13-25)16-11-23-24(2)12-16;/h4-6,9,11-12H,3,7-8,10,13H2,1-2H3,(H2,20,28)(H,21,22);1H |
| InChIKey | BUXSIEBTGNOFCC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|