C19H24N6O3 — CID 109436221
N'-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436221) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436221 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C19H24N6O3/c1-3-20-19(21-9-14-4-5-16-17(8-14)28-13-27-16)24-6-7-25(18(26)12-24)15-10-22-23(2)11-15/h4-5,8,10-11H,3,6-7,9,12-13H2,1-2H3,(H,20,21) |
| InChIKey | AGOROLLUAOVEFE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|