C16H22N6O2 — CID 109435779
N-ethyl-N'-(furan-2-ylmethyl)-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435779) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-ethyl-N'-(furan-2-ylmethyl)-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(furan-2-ylmethyl)-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435779 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-ethyl-N'-(furan-2-ylmethyl)-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccco1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C16H22N6O2/c1-3-17-16(18-10-14-5-4-8-24-14)21-6-7-22(15(23)12-21)13-9-19-20(2)11-13/h4-5,8-9,11H,3,6-7,10,12H2,1-2H3,(H,17,18) |
| InChIKey | SPLPODKOZWWJJR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|