C18H21F4IN6O — CID 109435122
N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[(2,3,5,6-tetrafluorophenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109435122) has the molecular formula C18H21F4IN6O and a molecular weight of 540.30 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[(2,3,5,6-tetrafluorophenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[(2,3,5,6-tetrafluorophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109435122 |
| Molecular Formula | C18H21F4IN6O |
| Molecular Weight | 540.30 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxo-N'-[(2,3,5,6-tetrafluorophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(F)c(F)cc(F)c1F)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C18H20F4N6O.HI/c1-3-23-18(24-8-12-16(21)13(19)6-14(20)17(12)22)27-4-5-28(15(29)10-27)11-7-25-26(2)9-11;/h6-7,9H,3-5,8,10H2,1-2H3,(H,23,24);1H |
| InChIKey | FWNWYPVISFXGMU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|