C16H21BrN6OS — CID 109433561
N'-[(5-bromothiophen-2-yl)methyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109433561) has the molecular formula C16H21BrN6OS and a molecular weight of 425.36 g/mol. Its IUPAC name is N'-[(5-bromothiophen-2-yl)methyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-[(5-bromothiophen-2-yl)methyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433561 |
| Molecular Formula | C16H21BrN6OS |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N'-[(5-bromothiophen-2-yl)methyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Br)s1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C16H21BrN6OS/c1-3-18-16(19-9-13-4-5-14(17)25-13)22-6-7-23(15(24)11-22)12-8-20-21(2)10-12/h4-5,8,10H,3,6-7,9,11H2,1-2H3,(H,18,19) |
| InChIKey | DYJQGXXKAULLFK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|