C18H25N7O2 — CID 109435195
N-ethyl-N'-[(2-methoxy-4-pyridinyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435195) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is N-ethyl-N'-[(2-methoxy-4-pyridinyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(2-methoxy-4-pyridinyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435195 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-ethyl-N'-[(2-methoxy-4-pyridinyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(OC)c1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H25N7O2/c1-4-19-18(21-10-14-5-6-20-16(9-14)27-3)24-7-8-25(17(26)13-24)15-11-22-23(2)12-15/h5-6,9,11-12H,4,7-8,10,13H2,1-3H3,(H,19,21) |
| InChIKey | OSYDNBQSBFCCAO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|