C22H33IN6O3 — CID 109435608
N-ethyl-N'-[[3-(3-methoxypropoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109435608) has the molecular formula C22H33IN6O3 and a molecular weight of 556.45 g/mol. Its IUPAC name is N-ethyl-N'-[[3-(3-methoxypropoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[3-(3-methoxypropoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109435608 |
| Molecular Formula | C22H33IN6O3 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | N-ethyl-N'-[[3-(3-methoxypropoxy)phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCCCOC)c1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C22H32N6O3.HI/c1-4-23-22(24-14-18-7-5-8-20(13-18)31-12-6-11-30-3)27-9-10-28(21(29)17-27)19-15-25-26(2)16-19;/h5,7-8,13,15-16H,4,6,9-12,14,17H2,1-3H3,(H,23,24);1H |
| InChIKey | UUXXRYOGDSSNHA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|