C23H30N8O — CID 109436695
N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436695) has the molecular formula C23H30N8O and a molecular weight of 434.55 g/mol. Its IUPAC name is N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436695 |
| Molecular Formula | C23H30N8O |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | N-ethyl-N'-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2C)c1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C23H30N8O/c1-4-24-23(30-10-11-31(22(32)17-30)21-14-27-28(3)16-21)26-13-19-6-5-7-20(12-19)15-29-9-8-25-18(29)2/h5-9,12,14,16H,4,10-11,13,15,17H2,1-3H3,(H,24,26) |
| InChIKey | PFZKGVMMTMSSIM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|