C19H27IN8O3 — CID 109435224
N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(2-nitroanilino)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109435224) has the molecular formula C19H27IN8O3 and a molecular weight of 542.38 g/mol. Its IUPAC name is N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(2-nitroanilino)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(2-nitroanilino)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109435224 |
| Molecular Formula | C19H27IN8O3 |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | N-ethyl-4-(1-methylpyrazol-4-yl)-N'-[2-(2-nitroanilino)ethyl]-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ccccc1[N+](=O)[O-])N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C19H26N8O3.HI/c1-3-20-19(22-9-8-21-16-6-4-5-7-17(16)27(29)30)25-10-11-26(18(28)14-25)15-12-23-24(2)13-15;/h4-7,12-13,21H,3,8-11,14H2,1-2H3,(H,20,22);1H |
| InChIKey | LXVIFJGVLPUZCE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|