C18H31N7O3 — CID 109436143
tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]carbamate (PubChem CID 109436143) has the molecular formula C18H31N7O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 109436143 |
| Molecular Formula | C18H31N7O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCNC(=O)OC(C)(C)C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H31N7O3/c1-6-19-16(20-7-8-21-17(27)28-18(2,3)4)24-9-10-25(15(26)13-24)14-11-22-23(5)12-14/h11-12H,6-10,13H2,1-5H3,(H,19,20)(H,21,27) |
| InChIKey | LUAPLWUYKJWLGR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|