C22H37N7O3 — CID 109436659
tert-butyl 4-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate (PubChem CID 109436659) has the molecular formula C22H37N7O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is tert-butyl 4-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109436659 |
| Molecular Formula | C22H37N7O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | tert-butyl 4-[[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC1CCN(C(=O)OC(C)(C)C)CC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C22H37N7O3/c1-6-23-20(28-11-12-29(19(30)16-28)18-14-25-26(5)15-18)24-13-17-7-9-27(10-8-17)21(31)32-22(2,3)4/h14-15,17H,6-13,16H2,1-5H3,(H,23,24) |
| InChIKey | VSUVXKCAYNGAPT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|