C19H33IN6O — CID 109434808
N-ethyl-N'-[(3-methylcyclohexyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109434808) has the molecular formula C19H33IN6O and a molecular weight of 488.42 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methylcyclohexyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-methylcyclohexyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434808 |
| Molecular Formula | C19H33IN6O |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | N-ethyl-N'-[(3-methylcyclohexyl)methyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCC(C)C1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C19H32N6O.HI/c1-4-20-19(21-11-16-7-5-6-15(2)10-16)24-8-9-25(18(26)14-24)17-12-22-23(3)13-17;/h12-13,15-16H,4-11,14H2,1-3H3,(H,20,21);1H |
| InChIKey | XOBDEJGHOIVPBS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|