C18H31IN6O2 — CID 109434704
N'-[3-(cyclopropylmethoxy)propyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide (PubChem CID 109434704) has the molecular formula C18H31IN6O2 and a molecular weight of 490.39 g/mol. Its IUPAC name is N'-[3-(cyclopropylmethoxy)propyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(cyclopropylmethoxy)propyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109434704 |
| Molecular Formula | C18H31IN6O2 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N'-[3-(cyclopropylmethoxy)propyl]-N-ethyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CC1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C18H30N6O2.HI/c1-3-19-18(20-7-4-10-26-14-15-5-6-15)23-8-9-24(17(25)13-23)16-11-21-22(2)12-16;/h11-12,15H,3-10,13-14H2,1-2H3,(H,19,20);1H |
| InChIKey | LZDWLMHPPBJDNZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|