C19H33N7O3 — CID 109434749
tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate (PubChem CID 109434749) has the molecular formula C19H33N7O3 and a molecular weight of 407.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 109434749 |
| Molecular Formula | C19H33N7O3 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate |
| SMILES | CCN/C(=N\CCN(C)C(=O)OC(C)(C)C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C19H33N7O3/c1-7-20-17(21-8-9-23(5)18(28)29-19(2,3)4)25-10-11-26(16(27)14-25)15-12-22-24(6)13-15/h12-13H,7-11,14H2,1-6H3,(H,20,21) |
| InChIKey | KQYAKNSBDAEUDX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|