C21H35N7O2 — CID 109434753
2-cyclohexyl-N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]acetamide (PubChem CID 109434753) has the molecular formula C21H35N7O2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 109434753 |
| Molecular Formula | C21H35N7O2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | 2-cyclohexyl-N-[2-[[ethylamino-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]methylidene]amino]ethyl]acetamide |
| SMILES | CCN/C(=N\CCNC(=O)CC1CCCCC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C21H35N7O2/c1-3-22-21(24-10-9-23-19(29)13-17-7-5-4-6-8-17)27-11-12-28(20(30)16-27)18-14-25-26(2)15-18/h14-15,17H,3-13,16H2,1-2H3,(H,22,24)(H,23,29) |
| InChIKey | AHOXLMGMMZVQJD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|