C18H32N6O3 — CID 110043961
2-[[(3-ethoxypropylamino)-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110043961) has the molecular formula C18H32N6O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110043961 |
| Molecular Formula | C18H32N6O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[4-(1,2-oxazol-3-ylmethyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)N1CCN(Cc2ccon2)CC1 |
| InChI | InChI=1S/C18H32N6O3/c1-4-26-12-5-7-19-18(20-14-17(25)22(2)3)24-10-8-23(9-11-24)15-16-6-13-27-21-16/h6,13H,4-5,7-12,14-15H2,1-3H3,(H,19,20) |
| InChIKey | HPWOGOIIRVDYKT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|