C20H31N5O3 — CID 110057768
N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethyl)piperazine-1-carboximidamide (PubChem CID 110057768) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110057768 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(1,2-oxazol-3-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N1CCN(Cc2ccon2)CC1 |
| InChI | InChI=1S/C20H31N5O3/c1-2-26-14-4-8-21-20(22-9-6-19-5-3-15-27-19)25-12-10-24(11-13-25)17-18-7-16-28-23-18/h3,5,7,15-16H,2,4,6,8-14,17H2,1H3,(H,21,22) |
| InChIKey | GLTLZPXCUZUGNT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|