C18H32IN3O2S — CID 110057585
N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 110057585) has the molecular formula C18H32IN3O2S and a molecular weight of 481.44 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110057585 |
| Molecular Formula | C18H32IN3O2S |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C18H31N3O2S.HI/c1-4-22-12-6-9-19-17(20-10-8-16-7-5-13-23-16)21-11-14-24-18(2,3)15-21;/h5,7,13H,4,6,8-12,14-15H2,1-3H3,(H,19,20);1H |
| InChIKey | UGILUWCSZYMVQA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|