C17H28IN3OS — CID 110057581
N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-methylprop-2-enyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 110057581) has the molecular formula C17H28IN3OS and a molecular weight of 449.40 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-methylprop-2-enyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-methylprop-2-enyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110057581 |
| Molecular Formula | C17H28IN3OS |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2,2-dimethyl-N'-(2-methylprop-2-enyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C=C(C)C/N=C(\NCCc1ccco1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C17H27N3OS.HI/c1-14(2)12-19-16(18-8-7-15-6-5-10-21-15)20-9-11-22-17(3,4)13-20;/h5-6,10H,1,7-9,11-13H2,2-4H3,(H,18,19);1H |
| InChIKey | ZTOWSUZUYZWHJI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|