C22H35N5O2 — CID 110058724
N-[2-(furan-2-yl)ethyl]-N'-(2-methylprop-2-enyl)-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)piperazine-1-carboximidamide (PubChem CID 110058724) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-N'-(2-methylprop-2-enyl)-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-N'-(2-methylprop-2-enyl)-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110058724 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-N'-(2-methylprop-2-enyl)-4-(1-oxo-1-pyrrolidin-1-ylpropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C=C(C)C/N=C(\NCCc1ccco1)N1CCN(C(C)C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H35N5O2/c1-18(2)17-24-22(23-9-8-20-7-6-16-29-20)27-14-12-25(13-15-27)19(3)21(28)26-10-4-5-11-26/h6-7,16,19H,1,4-5,8-15,17H2,2-3H3,(H,23,24) |
| InChIKey | ISNNAWOITRNKLX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|