C20H28N4O — CID 111493410
N-[2-(furan-2-yl)ethyl]-4-phenyl-N'-propylpiperazine-1-carboximidamide (PubChem CID 111493410) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-4-phenyl-N'-propylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-4-phenyl-N'-propylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111493410 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-4-phenyl-N'-propylpiperazine-1-carboximidamide |
| SMILES | CCC/N=C(\NCCc1ccco1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N4O/c1-2-11-21-20(22-12-10-19-9-6-17-25-19)24-15-13-23(14-16-24)18-7-4-3-5-8-18/h3-9,17H,2,10-16H2,1H3,(H,21,22) |
| InChIKey | YVPALYNZECKRPL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|