C18H28N6OS — CID 110057948
4-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-[2-(furan-2-yl)ethyl]-N'-propylpiperazine-1-carboximidamide (PubChem CID 110057948) has the molecular formula C18H28N6OS and a molecular weight of 376.53 g/mol. Its IUPAC name is 4-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-[2-(furan-2-yl)ethyl]-N'-propylpiperazine-1-carboximidamide.
| Compound Name | 4-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-[2-(furan-2-yl)ethyl]-N'-propylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110057948 |
| Molecular Formula | C18H28N6OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-[2-(furan-2-yl)ethyl]-N'-propylpiperazine-1-carboximidamide |
| SMILES | CCC/N=C(\NCCc1ccco1)N1CCN(c2nc(CC)ns2)CC1 |
| InChI | InChI=1S/C18H28N6OS/c1-3-8-19-17(20-9-7-15-6-5-14-25-15)23-10-12-24(13-11-23)18-21-16(4-2)22-26-18/h5-6,14H,3-4,7-13H2,1-2H3,(H,19,20) |
| InChIKey | MNJFMHPWFAQOAR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|