C21H31IN4O4 — CID 111166558
N'-(3-ethoxypropyl)-4-(furan-2-carbonyl)-N-[2-(furan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111166558) has the molecular formula C21H31IN4O4 and a molecular weight of 530.41 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-4-(furan-2-carbonyl)-N-[2-(furan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(3-ethoxypropyl)-4-(furan-2-carbonyl)-N-[2-(furan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111166558 |
| Molecular Formula | C21H31IN4O4 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | N'-(3-ethoxypropyl)-4-(furan-2-carbonyl)-N-[2-(furan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C21H30N4O4.HI/c1-2-27-15-5-9-22-21(23-10-8-18-6-3-16-28-18)25-13-11-24(12-14-25)20(26)19-7-4-17-29-19;/h3-4,6-7,16-17H,2,5,8-15H2,1H3,(H,22,23);1H |
| InChIKey | QATAUIMIEKOJRG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|