C23H40IN5O3 — CID 111419870
N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111419870) has the molecular formula C23H40IN5O3 and a molecular weight of 561.51 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111419870 |
| Molecular Formula | C23H40IN5O3 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N1CCN(CC(=O)N2CCCCC2)CC1.I |
| InChI | InChI=1S/C23H39N5O3.HI/c1-2-30-18-7-10-24-23(25-11-9-21-8-6-19-31-21)28-16-14-26(15-17-28)20-22(29)27-12-4-3-5-13-27;/h6,8,19H,2-5,7,9-18,20H2,1H3,(H,24,25);1H |
| InChIKey | GKOWARIDZSDFGL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|