C21H38IN5O4 — CID 111412165
2-[4-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111412165) has the molecular formula C21H38IN5O4 and a molecular weight of 551.47 g/mol. Its IUPAC name is 2-[4-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[4-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111412165 |
| Molecular Formula | C21H38IN5O4 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2-[4-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N1CCN(CC(=O)NCCOC)CC1.I |
| InChI | InChI=1S/C21H37N5O4.HI/c1-3-29-15-5-8-23-21(24-9-7-19-6-4-16-30-19)26-13-11-25(12-14-26)18-20(27)22-10-17-28-2;/h4,6,16H,3,5,7-15,17-18H2,1-2H3,(H,22,27)(H,23,24);1H |
| InChIKey | RRXIYHLPUCUONP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|