C21H38N4O3 — CID 110060790
N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide (PubChem CID 110060790) has the molecular formula C21H38N4O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide.
| Compound Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110060790 |
| Molecular Formula | C21H38N4O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N1CC(C)N(CCOC)C(C)C1 |
| InChI | InChI=1S/C21H38N4O3/c1-5-27-13-7-10-22-21(23-11-9-20-8-6-14-28-20)24-16-18(2)25(12-15-26-4)19(3)17-24/h6,8,14,18-19H,5,7,9-13,15-17H2,1-4H3,(H,22,23) |
| InChIKey | PSMSKWCPZGWHMV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|