C21H37IN4O4 — CID 111730558
tert-butyl N-[1-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide (PubChem CID 111730558) has the molecular formula C21H37IN4O4 and a molecular weight of 536.46 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111730558 |
| Molecular Formula | C21H37IN4O4 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | tert-butyl N-[1-[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]pyrrolidin-3-yl]carbamate;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)N1CCC(NC(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C21H36N4O4.HI/c1-5-27-14-7-11-22-19(23-12-9-18-8-6-15-28-18)25-13-10-17(16-25)24-20(26)29-21(2,3)4;/h6,8,15,17H,5,7,9-14,16H2,1-4H3,(H,22,23)(H,24,26);1H |
| InChIKey | SQXLTGHYIRTSII-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|