C18H33IN4O2 — CID 110060781
N-ethyl-N'-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110060781) has the molecular formula C18H33IN4O2 and a molecular weight of 464.39 g/mol. Its IUPAC name is N-ethyl-N'-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110060781 |
| Molecular Formula | C18H33IN4O2 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-ethyl-N'-[2-(furan-2-yl)ethyl]-4-(2-methoxyethyl)-3,5-dimethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccco1)N1CC(C)N(CCOC)C(C)C1.I |
| InChI | InChI=1S/C18H32N4O2.HI/c1-5-19-18(20-9-8-17-7-6-11-24-17)21-13-15(2)22(10-12-23-4)16(3)14-21;/h6-7,11,15-16H,5,8-10,12-14H2,1-4H3,(H,19,20);1H |
| InChIKey | SSGNUSPQCCBGDY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|