C17H30IN3O2 — CID 111143765
N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111143765) has the molecular formula C17H30IN3O2 and a molecular weight of 435.35 g/mol. Its IUPAC name is N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111143765 |
| Molecular Formula | C17H30IN3O2 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccco1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C17H29N3O2.HI/c1-3-18-17(20-10-4-7-15(2)13-20)19-9-6-11-21-14-16-8-5-12-22-16;/h5,8,12,15H,3-4,6-7,9-11,13-14H2,1-2H3,(H,18,19);1H |
| InChIKey | SEWBLMHGPPPENJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|