C17H30IN3O2 — CID 111153081
N-[3-(furan-2-ylmethoxy)propyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111153081) has the molecular formula C17H30IN3O2 and a molecular weight of 435.35 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxy)propyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-(furan-2-ylmethoxy)propyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111153081 |
| Molecular Formula | C17H30IN3O2 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[3-(furan-2-ylmethoxy)propyl]-N',3,5-trimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCc1ccco1)N1CC(C)CC(C)C1.I |
| InChI | InChI=1S/C17H29N3O2.HI/c1-14-10-15(2)12-20(11-14)17(18-3)19-7-5-8-21-13-16-6-4-9-22-16;/h4,6,9,14-15H,5,7-8,10-13H2,1-3H3,(H,18,19);1H |
| InChIKey | VVMKEZWOFZDRAV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|