C21H35N3O — CID 111153799
N',3,5-trimethyl-N-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide (PubChem CID 111153799) has the molecular formula C21H35N3O and a molecular weight of 345.53 g/mol. Its IUPAC name is N',3,5-trimethyl-N-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide.
| Compound Name | N',3,5-trimethyl-N-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111153799 |
| Molecular Formula | C21H35N3O |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | N',3,5-trimethyl-N-[4-(2-phenylethoxy)butyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCOCCc1ccccc1)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C21H35N3O/c1-18-15-19(2)17-24(16-18)21(22-3)23-12-7-8-13-25-14-11-20-9-5-4-6-10-20/h4-6,9-10,18-19H,7-8,11-17H2,1-3H3,(H,22,23) |
| InChIKey | OOZZOBJSTIUKFX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|