C25H36N4O2 — CID 111291275
4-(3-methoxyphenyl)-N'-methyl-N-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide (PubChem CID 111291275) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111291275 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[4-(2-phenylethoxy)butyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCOCCc1ccccc1)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-26-25(27-14-6-7-19-31-20-13-22-9-4-3-5-10-22)29-17-15-28(16-18-29)23-11-8-12-24(21-23)30-2/h3-5,8-12,21H,6-7,13-20H2,1-2H3,(H,26,27) |
| InChIKey | WXUOGBBKGGSEOA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|